C22H23Br3N4 — CID 161408035
1-benzyl-4-bromo-3-methylpyrazole;bromomethylbenzene;4-bromo-5-methyl-1H-pyrazole (PubChem CID 161408035) has the molecular formula C22H23Br3N4 and a molecular weight of 583.17 g/mol. Its IUPAC name is 1-benzyl-4-bromo-3-methylpyrazole;bromomethylbenzene;4-bromo-5-methyl-1H-pyrazole.
| Compound Name | 1-benzyl-4-bromo-3-methylpyrazole;bromomethylbenzene;4-bromo-5-methyl-1H-pyrazole |
|---|---|
| PubChem CID | 161408035 |
| Molecular Formula | C22H23Br3N4 |
| Molecular Weight | 583.17 g/mol |
| Exact Mass | 579.95 |
| IUPAC Name | 1-benzyl-4-bromo-3-methylpyrazole;bromomethylbenzene;4-bromo-5-methyl-1H-pyrazole |
| SMILES | BrCc1ccccc1.Cc1[nH]ncc1Br.Cc1nn(Cc2ccccc2)cc1Br |
| InChI | InChI=1S/C11H11BrN2.C7H7Br.C4H5BrN2/c1-9-11(12)8-14(13-9)7-10-5-3-2-4-6-10;8-6-7-4-2-1-3-5-7;1-3-4(5)2-6-7-3/h2-6,8H,7H2,1H3;1-5H,6H2;2H,1H3,(H,6,7) |
| InChIKey | VVCLXNKLPZGJJJ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.17 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|