C23H46O6Si2 — CID 161411840
triethoxy(4-methylidenehex-5-enyl)silane;trimethoxy(4-methylidenehex-5-enyl)silane (PubChem CID 161411840) has the molecular formula C23H46O6Si2 and a molecular weight of 474.79 g/mol. Its IUPAC name is triethoxy(4-methylidenehex-5-enyl)silane;trimethoxy(4-methylidenehex-5-enyl)silane.
| Compound Name | triethoxy(4-methylidenehex-5-enyl)silane;trimethoxy(4-methylidenehex-5-enyl)silane |
|---|---|
| PubChem CID | 161411840 |
| Molecular Formula | C23H46O6Si2 |
| Molecular Weight | 474.79 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | triethoxy(4-methylidenehex-5-enyl)silane;trimethoxy(4-methylidenehex-5-enyl)silane |
| SMILES | C=CC(=C)CCC[Si](OC)(OC)OC.C=CC(=C)CCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C13H26O3Si.C10H20O3Si/c1-6-13(5)11-10-12-17(14-7-2,15-8-3)16-9-4;1-6-10(2)8-7-9-14(11-3,12-4)13-5/h6H,1,5,7-12H2,2-4H3;6H,1-2,7-9H2,3-5H3 |
| InChIKey | VVOLRDVJOKHFBW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.79 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|