C40H58F2N4O6 — CID 161412120
4-[(4-fluoro-5-methyl-2-nitrophenyl)methyl]-1-(4-methoxycyclohexyl)piperidine (PubChem CID 161412120) has the molecular formula C40H58F2N4O6 and a molecular weight of 728.92 g/mol. Its IUPAC name is 4-[(4-fluoro-5-methyl-2-nitrophenyl)methyl]-1-(4-methoxycyclohexyl)piperidine.
| Compound Name | 4-[(4-fluoro-5-methyl-2-nitrophenyl)methyl]-1-(4-methoxycyclohexyl)piperidine |
|---|---|
| PubChem CID | 161412120 |
| Molecular Formula | C40H58F2N4O6 |
| Molecular Weight | 728.92 g/mol |
| Exact Mass | 728.43 |
| IUPAC Name | 4-[(4-fluoro-5-methyl-2-nitrophenyl)methyl]-1-(4-methoxycyclohexyl)piperidine |
| SMILES | COC1CCC(N2CCC(Cc3cc(C)c(F)cc3[N+](=O)[O-])CC2)CC1.COC1CCC(N2CCC(Cc3cc(C)c(F)cc3[N+](=O)[O-])CC2)CC1 |
| InChI | InChI=1S/2C20H29FN2O3/c2*1-14-11-16(20(23(24)25)13-19(14)21)12-15-7-9-22(10-8-15)17-3-5-18(26-2)6-4-17/h2*11,13,15,17-18H,3-10,12H2,1-2H3 |
| InChIKey | VVPJCZWQQVCZEJ-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 111.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.92 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|