C21H32FN3O3 — CID 69172996
N-(4-fluoro-5-methyl-2-nitrophenyl)-1-[(1S,3R)-3-propoxycyclohexyl]piperidin-4-amine (PubChem CID 69172996) has the molecular formula C21H32FN3O3 and a molecular weight of 393.50 g/mol. Its IUPAC name is N-(4-fluoro-5-methyl-2-nitrophenyl)-1-[(1S,3R)-3-propoxycyclohexyl]piperidin-4-amine.
| Compound Name | N-(4-fluoro-5-methyl-2-nitrophenyl)-1-[(1S,3R)-3-propoxycyclohexyl]piperidin-4-amine |
|---|---|
| PubChem CID | 69172996 |
| Molecular Formula | C21H32FN3O3 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | N-(4-fluoro-5-methyl-2-nitrophenyl)-1-[(1S,3R)-3-propoxycyclohexyl]piperidin-4-amine |
| SMILES | CCCO[C@@H]1CCC[C@H](N2CCC(Nc3cc(C)c(F)cc3[N+](=O)[O-])CC2)C1 |
| InChI | InChI=1S/C21H32FN3O3/c1-3-11-28-18-6-4-5-17(13-18)24-9-7-16(8-10-24)23-20-12-15(2)19(22)14-21(20)25(26)27/h12,14,16-18,23H,3-11,13H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | KTNBWLOVWXYCMI-ZWKOTPCHSA-N |
| XLogP | 4.66 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|