C10H9F2NO — CID 161413892
2-(difluoromethyl)-4-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 161413892) has the molecular formula C10H9F2NO and a molecular weight of 197.18 g/mol. Its IUPAC name is 2-(difluoromethyl)-4-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(difluoromethyl)-4-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 161413892 |
| Molecular Formula | C10H9F2NO |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-(difluoromethyl)-4-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | FC(F)C1=NC(c2ccccc2)CO1 |
| InChI | InChI=1S/C10H9F2NO/c11-9(12)10-13-8(6-14-10)7-4-2-1-3-5-7/h1-5,8-9H,6H2 |
| InChIKey | VVVCXRDSOYECBW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |