C15H16F3N3OS — CID 161415215
methanethioamide;N-[(Z)-[5-[4-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]ethanamine (PubChem CID 161415215) has the molecular formula C15H16F3N3OS and a molecular weight of 343.37 g/mol. Its IUPAC name is methanethioamide;N-[(Z)-[5-[4-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]ethanamine.
| Compound Name | methanethioamide;N-[(Z)-[5-[4-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]ethanamine |
|---|---|
| PubChem CID | 161415215 |
| Molecular Formula | C15H16F3N3OS |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | methanethioamide;N-[(Z)-[5-[4-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]ethanamine |
| SMILES | CCN/N=C\c1ccc(-c2ccc(C(F)(F)F)cc2)o1.NC=S |
| InChI | InChI=1S/C14H13F3N2O.CH3NS/c1-2-18-19-9-12-7-8-13(20-12)10-3-5-11(6-4-10)14(15,16)17;2-1-3/h3-9,18H,2H2,1H3;1H,(H2,2,3)/b19-9-; |
| InChIKey | VVZMEINSCMJDRE-MYOVXYCFSA-N |
| XLogP | 3.81 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|