C19H24O9 — CID 161418248
2,2-dimethyl-1,3-dioxane-4,6-dione;ethyl 3-(3,4-dimethoxyphenyl)-3-oxopropanoate (PubChem CID 161418248) has the molecular formula C19H24O9 and a molecular weight of 396.39 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dioxane-4,6-dione;ethyl 3-(3,4-dimethoxyphenyl)-3-oxopropanoate.
| Compound Name | 2,2-dimethyl-1,3-dioxane-4,6-dione;ethyl 3-(3,4-dimethoxyphenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 161418248 |
| Molecular Formula | C19H24O9 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2,2-dimethyl-1,3-dioxane-4,6-dione;ethyl 3-(3,4-dimethoxyphenyl)-3-oxopropanoate |
| SMILES | CC1(C)OC(=O)CC(=O)O1.CCOC(=O)CC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H16O5.C6H8O4/c1-4-18-13(15)8-10(14)9-5-6-11(16-2)12(7-9)17-3;1-6(2)9-4(7)3-5(8)10-6/h5-7H,4,8H2,1-3H3;3H2,1-2H3 |
| InChIKey | VWJOJFQBZNCGMM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|