About 7,7-diethylnonyl acetate
7,7-diethylnonyl acetate (PubChem CID 161418665) has the molecular formula C15H30O2
and a molecular weight of 242.40 g/mol. Its IUPAC name is 7,7-diethylnonyl acetate.
Molecular Properties
| Compound Name | 7,7-diethylnonyl acetate |
| PubChem CID | 161418665 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 7,7-diethylnonyl acetate |
| SMILES | CCC(CC)(CC)CCCCCCOC(C)=O |
| InChI | InChI=1S/C15H30O2/c1-5-15(6-2,7-3)12-10-8-9-11-13-17-14(4)16/h5-13H2,1-4H3 |
| InChIKey | VWKXQGVKXJVWOW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7,7-diethylnonyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-diethylnonyl acetate?
The IUPAC name of 7,7-diethylnonyl acetate (CID 161418665) is 7,7-diethylnonyl acetate.
What is the SMILES notation for 7,7-diethylnonyl acetate?
The canonical SMILES for 7,7-diethylnonyl acetate is CCC(CC)(CC)CCCCCCOC(C)=O.
What is the InChIKey of 7,7-diethylnonyl acetate?
The InChIKey is VWKXQGVKXJVWOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2/c1-5-15(6-2,7-3)12-10-8-9-11-13-17-14(4)16/h5-13H2,1-4H3.
What are the key properties of 7,7-diethylnonyl acetate?
7,7-diethylnonyl acetate has a molecular weight of 242.40 g/mol, XLogP of 4.72, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-diethylnonyl acetate is sourced from PubChem (CID 161418665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).