About 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one;methane
5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one;methane (PubChem CID 161418985) has the molecular formula C16H39N3O2
and a molecular weight of 305.51 g/mol. Its IUPAC name is 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one;methane.
Molecular Properties
| Compound Name | 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one;methane |
| PubChem CID | 161418985 |
| Molecular Formula | C16H39N3O2 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.30 |
| IUPAC Name | 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one;methane |
| SMILES | C.C.C.C.[H]/N=C(\C)CCC(C)=O.[H]/N=C(\C)CNCC(C)=O |
| InChI | InChI=1S/C6H12N2O.C6H11NO.4CH4/c1-5(7)3-8-4-6(2)9;1-5(7)3-4-6(2)8;;;;/h7-8H,3-4H2,1-2H3;7H,3-4H2,1-2H3;4*1H4/b2*7-5+;;;; |
| InChIKey | VWLWBSFTVXGGCY-PJEYGVTMSA-N |
| XLogP | 4.14 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one;methane?
The IUPAC name of 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one;methane (CID 161418985) is 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one;methane.
What is the SMILES notation for 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one;methane?
The canonical SMILES for 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one;methane is C.C.C.C.[H]/N=C(\C)CCC(C)=O.[H]/N=C(\C)CNCC(C)=O.
What is the InChIKey of 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one;methane?
The InChIKey is VWLWBSFTVXGGCY-PJEYGVTMSA-N. The full InChI is InChI=1S/C6H12N2O.C6H11NO.4CH4/c1-5(7)3-8-4-6(2)9;1-5(7)3-4-6(2)8;;;;/h7-8H,3-4H2,1-2H3;7H,3-4H2,1-2H3;4*1H4/b2*7-5+;;;;.
What are the key properties of 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one;methane?
5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one;methane has a molecular weight of 305.51 g/mol, XLogP of 4.14, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one;methane is sourced from PubChem (CID 161418985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).