About 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one
5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one (PubChem CID 162182119) has the molecular formula C12H23N3O2
and a molecular weight of 241.33 g/mol. Its IUPAC name is 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one.
Molecular Properties
| Compound Name | 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one |
| PubChem CID | 162182119 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one |
| SMILES | [H]/N=C(\C)CCC(C)=O.[H]/N=C(\C)CNCC(C)=O |
| InChI | InChI=1S/C6H12N2O.C6H11NO/c1-5(7)3-8-4-6(2)9;1-5(7)3-4-6(2)8/h7-8H,3-4H2,1-2H3;7H,3-4H2,1-2H3/b2*7-5+ |
| InChIKey | ZPDZXGBGRSFJMC-KWXHBDSUSA-N |
| XLogP | 1.60 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one?
The IUPAC name of 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one (CID 162182119) is 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one.
What is the SMILES notation for 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one?
The canonical SMILES for 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one is [H]/N=C(\C)CCC(C)=O.[H]/N=C(\C)CNCC(C)=O.
What is the InChIKey of 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one?
The InChIKey is ZPDZXGBGRSFJMC-KWXHBDSUSA-N. The full InChI is InChI=1S/C6H12N2O.C6H11NO/c1-5(7)3-8-4-6(2)9;1-5(7)3-4-6(2)8/h7-8H,3-4H2,1-2H3;7H,3-4H2,1-2H3/b2*7-5+.
What are the key properties of 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one?
5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one has a molecular weight of 241.33 g/mol, XLogP of 1.60, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iminohexan-2-one;1-(2-iminopropylamino)propan-2-one is sourced from PubChem (CID 162182119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).