About imino(phosphanyl)phosphane;(4-nitrophenyl) 2-methylpropanoate
imino(phosphanyl)phosphane;(4-nitrophenyl) 2-methylpropanoate (PubChem CID 161419042) has the molecular formula C10H14N2O4P2
and a molecular weight of 288.18 g/mol. Its IUPAC name is imino(phosphanyl)phosphane;(4-nitrophenyl) 2-methylpropanoate.
Molecular Properties
| Compound Name | imino(phosphanyl)phosphane;(4-nitrophenyl) 2-methylpropanoate |
| PubChem CID | 161419042 |
| Molecular Formula | C10H14N2O4P2 |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | imino(phosphanyl)phosphane;(4-nitrophenyl) 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1ccc([N+](=O)[O-])cc1.[H]/N=P/P |
| InChI | InChI=1S/C10H11NO4.H3NP2/c1-7(2)10(12)15-9-5-3-8(4-6-9)11(13)14;1-3-2/h3-7H,1-2H3;1H,2H2 |
| InChIKey | VWLZUUXEUWMHRC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze imino(phosphanyl)phosphane;(4-nitrophenyl) 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino(phosphanyl)phosphane;(4-nitrophenyl) 2-methylpropanoate?
The IUPAC name of imino(phosphanyl)phosphane;(4-nitrophenyl) 2-methylpropanoate (CID 161419042) is imino(phosphanyl)phosphane;(4-nitrophenyl) 2-methylpropanoate.
What is the SMILES notation for imino(phosphanyl)phosphane;(4-nitrophenyl) 2-methylpropanoate?
The canonical SMILES for imino(phosphanyl)phosphane;(4-nitrophenyl) 2-methylpropanoate is CC(C)C(=O)Oc1ccc([N+](=O)[O-])cc1.[H]/N=P/P.
What is the InChIKey of imino(phosphanyl)phosphane;(4-nitrophenyl) 2-methylpropanoate?
The InChIKey is VWLZUUXEUWMHRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4.H3NP2/c1-7(2)10(12)15-9-5-3-8(4-6-9)11(13)14;1-3-2/h3-7H,1-2H3;1H,2H2.
What are the key properties of imino(phosphanyl)phosphane;(4-nitrophenyl) 2-methylpropanoate?
imino(phosphanyl)phosphane;(4-nitrophenyl) 2-methylpropanoate has a molecular weight of 288.18 g/mol, XLogP of 3.64, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for imino(phosphanyl)phosphane;(4-nitrophenyl) 2-methylpropanoate is sourced from PubChem (CID 161419042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).