About 1-O-(4-nitrophenyl) 4-O-phosphanyl (2S)-2-(phosphanylphosphanylideneamino)butanedioate
1-O-(4-nitrophenyl) 4-O-phosphanyl (2S)-2-(phosphanylphosphanylideneamino)butanedioate (PubChem CID 90346651) has the molecular formula C10H11N2O6P3
and a molecular weight of 348.13 g/mol. Its IUPAC name is 1-O-(4-nitrophenyl) 4-O-phosphanyl (2S)-2-(phosphanylphosphanylideneamino)butanedioate.
Molecular Properties
| Compound Name | 1-O-(4-nitrophenyl) 4-O-phosphanyl (2S)-2-(phosphanylphosphanylideneamino)butanedioate |
| PubChem CID | 90346651 |
| Molecular Formula | C10H11N2O6P3 |
| Molecular Weight | 348.13 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 1-O-(4-nitrophenyl) 4-O-phosphanyl (2S)-2-(phosphanylphosphanylideneamino)butanedioate |
| SMILES | O=C(C[C@H](/N=P/P)C(=O)Oc1ccc([N+](=O)[O-])cc1)OP |
| InChI | InChI=1S/C10H11N2O6P3/c13-9(18-19)5-8(11-21-20)10(14)17-7-3-1-6(2-4-7)12(15)16/h1-4,8H,5,19-20H2/t8-/m0/s1 |
| InChIKey | ULTLRLVQLZHESF-QMMMGPOBSA-N |
| XLogP | 2.51 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.13 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(4-nitrophenyl) 4-O-phosphanyl (2S)-2-(phosphanylphosphanylideneamino)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(4-nitrophenyl) 4-O-phosphanyl (2S)-2-(phosphanylphosphanylideneamino)butanedioate?
The IUPAC name of 1-O-(4-nitrophenyl) 4-O-phosphanyl (2S)-2-(phosphanylphosphanylideneamino)butanedioate (CID 90346651) is 1-O-(4-nitrophenyl) 4-O-phosphanyl (2S)-2-(phosphanylphosphanylideneamino)butanedioate.
What is the SMILES notation for 1-O-(4-nitrophenyl) 4-O-phosphanyl (2S)-2-(phosphanylphosphanylideneamino)butanedioate?
The canonical SMILES for 1-O-(4-nitrophenyl) 4-O-phosphanyl (2S)-2-(phosphanylphosphanylideneamino)butanedioate is O=C(C[C@H](/N=P/P)C(=O)Oc1ccc([N+](=O)[O-])cc1)OP.
What is the InChIKey of 1-O-(4-nitrophenyl) 4-O-phosphanyl (2S)-2-(phosphanylphosphanylideneamino)butanedioate?
The InChIKey is ULTLRLVQLZHESF-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H11N2O6P3/c13-9(18-19)5-8(11-21-20)10(14)17-7-3-1-6(2-4-7)12(15)16/h1-4,8H,5,19-20H2/t8-/m0/s1.
What are the key properties of 1-O-(4-nitrophenyl) 4-O-phosphanyl (2S)-2-(phosphanylphosphanylideneamino)butanedioate?
1-O-(4-nitrophenyl) 4-O-phosphanyl (2S)-2-(phosphanylphosphanylideneamino)butanedioate has a molecular weight of 348.13 g/mol, XLogP of 2.51, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(4-nitrophenyl) 4-O-phosphanyl (2S)-2-(phosphanylphosphanylideneamino)butanedioate is sourced from PubChem (CID 90346651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).