C27H37NO7 — CID 161423785
benzyl 3-hydroxypentanoate;benzyl 3-[[(2S)-1-oxopropan-2-yl]amino]oxypentanoate (PubChem CID 161423785) has the molecular formula C27H37NO7 and a molecular weight of 487.59 g/mol. Its IUPAC name is benzyl 3-hydroxypentanoate;benzyl 3-[[(2S)-1-oxopropan-2-yl]amino]oxypentanoate.
| Compound Name | benzyl 3-hydroxypentanoate;benzyl 3-[[(2S)-1-oxopropan-2-yl]amino]oxypentanoate |
|---|---|
| PubChem CID | 161423785 |
| Molecular Formula | C27H37NO7 |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | benzyl 3-hydroxypentanoate;benzyl 3-[[(2S)-1-oxopropan-2-yl]amino]oxypentanoate |
| SMILES | CCC(CC(=O)OCc1ccccc1)ON[C@@H](C)C=O.CCC(O)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H21NO4.C12H16O3/c1-3-14(20-16-12(2)10-17)9-15(18)19-11-13-7-5-4-6-8-13;1-2-11(13)8-12(14)15-9-10-6-4-3-5-7-10/h4-8,10,12,14,16H,3,9,11H2,1-2H3;3-7,11,13H,2,8-9H2,1H3/t12-,14?;/m0./s1 |
| InChIKey | VXBXQRFKUGDVFW-GUDMUQDVSA-N |
| XLogP | 3.90 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|