C25H17F6N3O3S — CID 161424774
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-5-naphthalen-1-yl-2-sulfonyl-1H-pyrimidine-6-carboxamide (PubChem CID 161424774) has the molecular formula C25H17F6N3O3S and a molecular weight of 553.48 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-5-naphthalen-1-yl-2-sulfonyl-1H-pyrimidine-6-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-5-naphthalen-1-yl-2-sulfonyl-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 161424774 |
| Molecular Formula | C25H17F6N3O3S |
| Molecular Weight | 553.48 g/mol |
| Exact Mass | 553.09 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-5-naphthalen-1-yl-2-sulfonyl-1H-pyrimidine-6-carboxamide |
| SMILES | CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)c1[nH]c(=S(=O)=O)ncc1-c1cccc2ccccc12 |
| InChI | InChI=1S/C25H17F6N3O3S/c1-34(13-14-9-16(24(26,27)28)11-17(10-14)25(29,30)31)22(35)21-20(12-32-23(33-21)38(36)37)19-8-4-6-15-5-2-3-7-18(15)19/h2-12,33H,13H2,1H3 |
| InChIKey | SDYVTSOMYWFMGP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|