C32H22F6N2O2S — CID 139827766
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-10-naphthalen-1-yl-12-oxo-4-thia-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxamide (PubChem CID 139827766) has the molecular formula C32H22F6N2O2S and a molecular weight of 612.60 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-10-naphthalen-1-yl-12-oxo-4-thia-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-10-naphthalen-1-yl-12-oxo-4-thia-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 139827766 |
| Molecular Formula | C32H22F6N2O2S |
| Molecular Weight | 612.60 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-10-naphthalen-1-yl-12-oxo-4-thia-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxamide |
| SMILES | CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)c1c(-c2cccc3ccccc23)c2cccc3c2n(c1=O)CCS3 |
| InChI | InChI=1S/C32H22F6N2O2S/c1-39(17-18-14-20(31(33,34)35)16-21(15-18)32(36,37)38)29(41)27-26(23-9-4-7-19-6-2-3-8-22(19)23)24-10-5-11-25-28(24)40(30(27)42)12-13-43-25/h2-11,14-16H,12-13,17H2,1H3 |
| InChIKey | HEVJNUJYGXXPCI-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.60 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |