C31H26F6N2O5 — CID 139827765
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-[3-(2-methoxyethoxy)phenyl]-N-methyl-12-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxamide (PubChem CID 139827765) has the molecular formula C31H26F6N2O5 and a molecular weight of 620.55 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-[3-(2-methoxyethoxy)phenyl]-N-methyl-12-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-[3-(2-methoxyethoxy)phenyl]-N-methyl-12-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 139827765 |
| Molecular Formula | C31H26F6N2O5 |
| Molecular Weight | 620.55 g/mol |
| Exact Mass | 620.17 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-[3-(2-methoxyethoxy)phenyl]-N-methyl-12-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxamide |
| SMILES | COCCOc1cccc(-c2c(C(=O)N(C)Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(=O)n3c4c(cccc24)OCC3)c1 |
| InChI | InChI=1S/C31H26F6N2O5/c1-38(17-18-13-20(30(32,33)34)16-21(14-18)31(35,36)37)28(40)26-25(19-5-3-6-22(15-19)43-12-11-42-2)23-7-4-8-24-27(23)39(29(26)41)9-10-44-24/h3-8,13-16H,9-12,17H2,1-2H3 |
| InChIKey | SMCOAERAOSDDJU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|