C29H20F6N2O4 — CID 139827761
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-(4-formylphenyl)-N-methyl-12-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxamide (PubChem CID 139827761) has the molecular formula C29H20F6N2O4 and a molecular weight of 574.48 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-(4-formylphenyl)-N-methyl-12-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-(4-formylphenyl)-N-methyl-12-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 139827761 |
| Molecular Formula | C29H20F6N2O4 |
| Molecular Weight | 574.48 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-(4-formylphenyl)-N-methyl-12-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxamide |
| SMILES | CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)c1c(-c2ccc(C=O)cc2)c2cccc3c2n(c1=O)CCO3 |
| InChI | InChI=1S/C29H20F6N2O4/c1-36(14-17-11-19(28(30,31)32)13-20(12-17)29(33,34)35)26(39)24-23(18-7-5-16(15-38)6-8-18)21-3-2-4-22-25(21)37(27(24)40)9-10-41-22/h2-8,11-13,15H,9-10,14H2,1H3 |
| InChIKey | SDDGAQIGDKLHGU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.48 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|