C29H23F6N3O2 — CID 139821897
4-(3-aminophenyl)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-2-oxo-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene-3-carboxamide (PubChem CID 139821897) has the molecular formula C29H23F6N3O2 and a molecular weight of 559.51 g/mol. Its IUPAC name is 4-(3-aminophenyl)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-2-oxo-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene-3-carboxamide.
| Compound Name | 4-(3-aminophenyl)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-2-oxo-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 139821897 |
| Molecular Formula | C29H23F6N3O2 |
| Molecular Weight | 559.51 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | 4-(3-aminophenyl)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-2-oxo-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene-3-carboxamide |
| SMILES | CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)c1c(-c2cccc(N)c2)c2cccc3c2n(c1=O)CCC3 |
| InChI | InChI=1S/C29H23F6N3O2/c1-37(15-16-11-19(28(30,31)32)14-20(12-16)29(33,34)35)26(39)24-23(18-6-2-8-21(36)13-18)22-9-3-5-17-7-4-10-38(25(17)22)27(24)40/h2-3,5-6,8-9,11-14H,4,7,10,15,36H2,1H3 |
| InChIKey | KYHNFZKTFYDDPZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.51 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|