C19H20BBrF6N2O4 — CID 161428852
5-bromo-2-(2,2,2-trifluoroethoxy)pyridine;5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-(2,2,2-trifluoroethoxy)pyridine (PubChem CID 161428852) has the molecular formula C19H20BBrF6N2O4 and a molecular weight of 545.08 g/mol. Its IUPAC name is 5-bromo-2-(2,2,2-trifluoroethoxy)pyridine;5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-(2,2,2-trifluoroethoxy)pyridine.
| Compound Name | 5-bromo-2-(2,2,2-trifluoroethoxy)pyridine;5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-(2,2,2-trifluoroethoxy)pyridine |
|---|---|
| PubChem CID | 161428852 |
| Molecular Formula | C19H20BBrF6N2O4 |
| Molecular Weight | 545.08 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | 5-bromo-2-(2,2,2-trifluoroethoxy)pyridine;5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-(2,2,2-trifluoroethoxy)pyridine |
| SMILES | CC1(C)COB(c2ccc(OCC(F)(F)F)nc2)OC1.FC(F)(F)COc1ccc(Br)cn1 |
| InChI | InChI=1S/C12H15BF3NO3.C7H5BrF3NO/c1-11(2)6-19-13(20-7-11)9-3-4-10(17-5-9)18-8-12(14,15)16;8-5-1-2-6(12-3-5)13-4-7(9,10)11/h3-5H,6-8H2,1-2H3;1-3H,4H2 |
| InChIKey | VXSVQMKVYDFOEJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.08 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|