About dec-2-enal;octanoic acid;oct-3-en-2-one
dec-2-enal;octanoic acid;oct-3-en-2-one (PubChem CID 161435460) has the molecular formula C26H48O4
and a molecular weight of 424.67 g/mol. Its IUPAC name is dec-2-enal;octanoic acid;oct-3-en-2-one.
Molecular Properties
| Compound Name | dec-2-enal;octanoic acid;oct-3-en-2-one |
| PubChem CID | 161435460 |
| Molecular Formula | C26H48O4 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.36 |
| IUPAC Name | dec-2-enal;octanoic acid;oct-3-en-2-one |
| SMILES | CCCCC=CC(C)=O.CCCCCCCC(=O)O.CCCCCCCC=CC=O |
| InChI | InChI=1S/C10H18O.C8H16O2.C8H14O/c1-2-3-4-5-6-7-8-9-10-11;1-2-3-4-5-6-7-8(9)10;1-3-4-5-6-7-8(2)9/h8-10H,2-7H2,1H3;2-7H2,1H3,(H,9,10);6-7H,3-5H2,1-2H3 |
| InChIKey | VYOWDEVKOZCZHX-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dec-2-enal;octanoic acid;oct-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-2-enal;octanoic acid;oct-3-en-2-one?
The IUPAC name of dec-2-enal;octanoic acid;oct-3-en-2-one (CID 161435460) is dec-2-enal;octanoic acid;oct-3-en-2-one.
What is the SMILES notation for dec-2-enal;octanoic acid;oct-3-en-2-one?
The canonical SMILES for dec-2-enal;octanoic acid;oct-3-en-2-one is CCCCC=CC(C)=O.CCCCCCCC(=O)O.CCCCCCCC=CC=O.
What is the InChIKey of dec-2-enal;octanoic acid;oct-3-en-2-one?
The InChIKey is VYOWDEVKOZCZHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O.C8H16O2.C8H14O/c1-2-3-4-5-6-7-8-9-10-11;1-2-3-4-5-6-7-8(9)10;1-3-4-5-6-7-8(2)9/h8-10H,2-7H2,1H3;2-7H2,1H3,(H,9,10);6-7H,3-5H2,1-2H3.
What are the key properties of dec-2-enal;octanoic acid;oct-3-en-2-one?
dec-2-enal;octanoic acid;oct-3-en-2-one has a molecular weight of 424.67 g/mol, XLogP of 7.86, 17 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dec-2-enal;octanoic acid;oct-3-en-2-one is sourced from PubChem (CID 161435460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).