C42H52N10O8 — CID 161436210
2-[(E)-2-(4-methoxyphenyl)ethenyl]-4,6-dimorpholin-4-ylpyrimidin-5-amine;4-[2-[(E)-2-(4-methoxyphenyl)ethenyl]-6-morpholin-4-yl-5-nitropyrimidin-4-yl]morpholine (PubChem CID 161436210) has the molecular formula C42H52N10O8 and a molecular weight of 824.94 g/mol. Its IUPAC name is 2-[(E)-2-(4-methoxyphenyl)ethenyl]-4,6-dimorpholin-4-ylpyrimidin-5-amine;4-[2-[(E)-2-(4-methoxyphenyl)ethenyl]-6-morpholin-4-yl-5-nitropyrimidin-4-yl]morpholine.
| Compound Name | 2-[(E)-2-(4-methoxyphenyl)ethenyl]-4,6-dimorpholin-4-ylpyrimidin-5-amine;4-[2-[(E)-2-(4-methoxyphenyl)ethenyl]-6-morpholin-4-yl-5-nitropyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 161436210 |
| Molecular Formula | C42H52N10O8 |
| Molecular Weight | 824.94 g/mol |
| Exact Mass | 824.40 |
| IUPAC Name | 2-[(E)-2-(4-methoxyphenyl)ethenyl]-4,6-dimorpholin-4-ylpyrimidin-5-amine;4-[2-[(E)-2-(4-methoxyphenyl)ethenyl]-6-morpholin-4-yl-5-nitropyrimidin-4-yl]morpholine |
| SMILES | COc1ccc(/C=C/c2nc(N3CCOCC3)c(N)c(N3CCOCC3)n2)cc1.COc1ccc(/C=C/c2nc(N3CCOCC3)c([N+](=O)[O-])c(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C21H25N5O5.C21H27N5O3/c1-29-17-5-2-16(3-6-17)4-7-18-22-20(24-8-12-30-13-9-24)19(26(27)28)21(23-18)25-10-14-31-15-11-25;1-27-17-5-2-16(3-6-17)4-7-18-23-20(25-8-12-28-13-9-25)19(22)21(24-18)26-10-14-29-15-11-26/h2-7H,8-15H2,1H3;2-7H,8-15,22H2,1H3/b2*7-4+ |
| InChIKey | VYRHEYPZIFFIMP-YZMNHHIASA-N |
| XLogP | 4.15 |
| TPSA | 189.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.94 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|