C20H24FN5O2 — CID 66913072
2-[2-(4-fluorophenyl)ethenyl]-4,6-dimorpholin-4-ylpyrimidin-5-amine (PubChem CID 66913072) has the molecular formula C20H24FN5O2 and a molecular weight of 385.44 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)ethenyl]-4,6-dimorpholin-4-ylpyrimidin-5-amine.
| Compound Name | 2-[2-(4-fluorophenyl)ethenyl]-4,6-dimorpholin-4-ylpyrimidin-5-amine |
|---|---|
| PubChem CID | 66913072 |
| Molecular Formula | C20H24FN5O2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2-[2-(4-fluorophenyl)ethenyl]-4,6-dimorpholin-4-ylpyrimidin-5-amine |
| SMILES | Nc1c(N2CCOCC2)nc(C=Cc2ccc(F)cc2)nc1N1CCOCC1 |
| InChI | InChI=1S/C20H24FN5O2/c21-16-4-1-15(2-5-16)3-6-17-23-19(25-7-11-27-12-8-25)18(22)20(24-17)26-9-13-28-14-10-26/h1-6H,7-14,22H2 |
| InChIKey | QRSQPYKXXHHNAF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |