C26H47NO7 — CID 161446448
(2S)-1-(2,3-dihydroxypropyl)-5-oxopyrrolidine-2-carboxylic acid;(Z)-octadec-9-enoic acid (PubChem CID 161446448) has the molecular formula C26H47NO7 and a molecular weight of 485.66 g/mol. Its IUPAC name is (2S)-1-(2,3-dihydroxypropyl)-5-oxopyrrolidine-2-carboxylic acid;(Z)-octadec-9-enoic acid.
| Compound Name | (2S)-1-(2,3-dihydroxypropyl)-5-oxopyrrolidine-2-carboxylic acid;(Z)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 161446448 |
| Molecular Formula | C26H47NO7 |
| Molecular Weight | 485.66 g/mol |
| Exact Mass | 485.34 |
| IUPAC Name | (2S)-1-(2,3-dihydroxypropyl)-5-oxopyrrolidine-2-carboxylic acid;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.O=C(O)[C@@H]1CCC(=O)N1CC(O)CO |
| InChI | InChI=1S/C18H34O2.C8H13NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;10-4-5(11)3-9-6(8(13)14)1-2-7(9)12/h9-10H,2-8,11-17H2,1H3,(H,19,20);5-6,10-11H,1-4H2,(H,13,14)/b10-9-;/t;5?,6-/m.0/s1 |
| InChIKey | VZYLCVCQTBWEJL-GTFPNCJPSA-N |
| XLogP | 4.52 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.66 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|