C58H45N15 — CID 161450405
3-[2,4-bis[2,7-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-3-methylphenyl]benzonitrile (PubChem CID 161450405) has the molecular formula C58H45N15 and a molecular weight of 952.10 g/mol. Its IUPAC name is 3-[2,4-bis[2,7-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-3-methylphenyl]benzonitrile.
| Compound Name | 3-[2,4-bis[2,7-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-3-methylphenyl]benzonitrile |
|---|---|
| PubChem CID | 161450405 |
| Molecular Formula | C58H45N15 |
| Molecular Weight | 952.10 g/mol |
| Exact Mass | 951.40 |
| IUPAC Name | 3-[2,4-bis[2,7-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-3-methylphenyl]benzonitrile |
| SMILES | Cc1nc(C)nc(-c2ccc3c4ccc(-c5nc(C)nc(C)n5)cc4n(-c4ccc(-c5cccc(C#N)c5)c(-n5c6cc(-c7nc(C)nc(C)n7)ccc6c6ccc(-c7nc(C)nc(C)n7)cc65)c4C)c3c2)n1 |
| InChI | InChI=1S/C58H45N15/c1-29-49(72-50-24-40(55-64-30(2)60-31(3)65-55)13-17-45(50)46-18-14-41(25-51(46)72)56-66-32(4)61-33(5)67-56)22-21-44(39-12-10-11-38(23-39)28-59)54(29)73-52-26-42(57-68-34(6)62-35(7)69-57)15-19-47(52)48-20-16-43(27-53(48)73)58-70-36(8)63-37(9)71-58/h10-27H,1-9H3 |
| InChIKey | DSVVKTCIPNGPGV-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 188.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.10 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |