About N-(benzhydrylideneamino)hydroxylamine;4-methoxypyridine
N-(benzhydrylideneamino)hydroxylamine;4-methoxypyridine (PubChem CID 161458787) has the molecular formula C19H19N3O2
and a molecular weight of 321.38 g/mol. Its IUPAC name is N-(benzhydrylideneamino)hydroxylamine;4-methoxypyridine.
Molecular Properties
| Compound Name | N-(benzhydrylideneamino)hydroxylamine;4-methoxypyridine |
| PubChem CID | 161458787 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-(benzhydrylideneamino)hydroxylamine;4-methoxypyridine |
| SMILES | COc1ccncc1.ONN=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H12N2O.C6H7NO/c16-15-14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-8-6-2-4-7-5-3-6/h1-10,15-16H;2-5H,1H3 |
| InChIKey | WBNFFBLSLKTNGH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(benzhydrylideneamino)hydroxylamine;4-methoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(benzhydrylideneamino)hydroxylamine;4-methoxypyridine?
The IUPAC name of N-(benzhydrylideneamino)hydroxylamine;4-methoxypyridine (CID 161458787) is N-(benzhydrylideneamino)hydroxylamine;4-methoxypyridine.
What is the SMILES notation for N-(benzhydrylideneamino)hydroxylamine;4-methoxypyridine?
The canonical SMILES for N-(benzhydrylideneamino)hydroxylamine;4-methoxypyridine is COc1ccncc1.ONN=C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(benzhydrylideneamino)hydroxylamine;4-methoxypyridine?
The InChIKey is WBNFFBLSLKTNGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O.C6H7NO/c16-15-14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-8-6-2-4-7-5-3-6/h1-10,15-16H;2-5H,1H3.
What are the key properties of N-(benzhydrylideneamino)hydroxylamine;4-methoxypyridine?
N-(benzhydrylideneamino)hydroxylamine;4-methoxypyridine has a molecular weight of 321.38 g/mol, XLogP of 3.51, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(benzhydrylideneamino)hydroxylamine;4-methoxypyridine is sourced from PubChem (CID 161458787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).