C18H23N7O7 — CID 161459877
5-cyclopentyl-4-nitro-1H-pyrazole-3-carboxamide;5-cyclopentyl-4-nitro-1H-pyrazole-3-carboxylic acid (PubChem CID 161459877) has the molecular formula C18H23N7O7 and a molecular weight of 449.42 g/mol. Its IUPAC name is 5-cyclopentyl-4-nitro-1H-pyrazole-3-carboxamide;5-cyclopentyl-4-nitro-1H-pyrazole-3-carboxylic acid.
| Compound Name | 5-cyclopentyl-4-nitro-1H-pyrazole-3-carboxamide;5-cyclopentyl-4-nitro-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 161459877 |
| Molecular Formula | C18H23N7O7 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 5-cyclopentyl-4-nitro-1H-pyrazole-3-carboxamide;5-cyclopentyl-4-nitro-1H-pyrazole-3-carboxylic acid |
| SMILES | NC(=O)c1n[nH]c(C2CCCC2)c1[N+](=O)[O-].O=C(O)c1n[nH]c(C2CCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N4O3.C9H11N3O4/c10-9(14)7-8(13(15)16)6(11-12-7)5-3-1-2-4-5;13-9(14)7-8(12(15)16)6(10-11-7)5-3-1-2-4-5/h5H,1-4H2,(H2,10,14)(H,11,12);5H,1-4H2,(H,10,11)(H,13,14) |
| InChIKey | WBQRCFDTRXTOMU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 224.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|