C16H23N7O7 — CID 157496137
5-tert-butyl-4-nitro-1H-pyrazole-3-carboxamide;5-tert-butyl-4-nitro-1H-pyrazole-3-carboxylic acid (PubChem CID 157496137) has the molecular formula C16H23N7O7 and a molecular weight of 425.40 g/mol. Its IUPAC name is 5-tert-butyl-4-nitro-1H-pyrazole-3-carboxamide;5-tert-butyl-4-nitro-1H-pyrazole-3-carboxylic acid.
| Compound Name | 5-tert-butyl-4-nitro-1H-pyrazole-3-carboxamide;5-tert-butyl-4-nitro-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 157496137 |
| Molecular Formula | C16H23N7O7 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 5-tert-butyl-4-nitro-1H-pyrazole-3-carboxamide;5-tert-butyl-4-nitro-1H-pyrazole-3-carboxylic acid |
| SMILES | CC(C)(C)c1[nH]nc(C(=O)O)c1[N+](=O)[O-].CC(C)(C)c1[nH]nc(C(N)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H12N4O3.C8H11N3O4/c1-8(2,3)6-5(12(14)15)4(7(9)13)10-11-6;1-8(2,3)6-5(11(14)15)4(7(12)13)9-10-6/h1-3H3,(H2,9,13)(H,10,11);1-3H3,(H,9,10)(H,12,13) |
| InChIKey | BXVWYHSSXREZKL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 224.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|