C6H10N4O — CID 57073549
5-(aminomethyl)-4-methyl-1H-pyrazole-3-carboxamide (PubChem CID 57073549) has the molecular formula C6H10N4O and a molecular weight of 154.17 g/mol. Its IUPAC name is 5-(aminomethyl)-4-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(aminomethyl)-4-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 57073549 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 5-(aminomethyl)-4-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1c(C(N)=O)n[nH]c1CN |
| InChI | InChI=1S/C6H10N4O/c1-3-4(2-7)9-10-5(3)6(8)11/h2,7H2,1H3,(H2,8,11)(H,9,10) |
| InChIKey | KUDWRFJEHVRRIH-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |