C6H8BrN3O — CID 130118792
4-bromo-5-ethyl-1H-pyrazole-3-carboxamide (PubChem CID 130118792) has the molecular formula C6H8BrN3O and a molecular weight of 218.05 g/mol. Its IUPAC name is 4-bromo-5-ethyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-bromo-5-ethyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 130118792 |
| Molecular Formula | C6H8BrN3O |
| Molecular Weight | 218.05 g/mol |
| Exact Mass | 216.99 |
| IUPAC Name | 4-bromo-5-ethyl-1H-pyrazole-3-carboxamide |
| SMILES | CCc1[nH]nc(C(N)=O)c1Br |
| InChI | InChI=1S/C6H8BrN3O/c1-2-3-4(7)5(6(8)11)10-9-3/h2H2,1H3,(H2,8,11)(H,9,10) |
| InChIKey | YMZDQHOKOPLRLW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.05 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |