C6H10N4O2 — CID 155251418
4-amino-5-(2-hydroxyethyl)-1H-pyrazole-3-carboxamide (PubChem CID 155251418) has the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. Its IUPAC name is 4-amino-5-(2-hydroxyethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-5-(2-hydroxyethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 155251418 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 4-amino-5-(2-hydroxyethyl)-1H-pyrazole-3-carboxamide |
| SMILES | NC(=O)c1n[nH]c(CCO)c1N |
| InChI | InChI=1S/C6H10N4O2/c7-4-3(1-2-11)9-10-5(4)6(8)12/h11H,1-2,7H2,(H2,8,12)(H,9,10) |
| InChIKey | NHQRJCVCUDWBFF-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |