C9H12N4O5 — CID 119359295
2-[methyl-(5-methyl-4-nitro-1H-pyrazole-3-carbonyl)amino]propanoic acid (PubChem CID 119359295) has the molecular formula C9H12N4O5 and a molecular weight of 256.22 g/mol. Its IUPAC name is 2-[methyl-(5-methyl-4-nitro-1H-pyrazole-3-carbonyl)amino]propanoic acid.
| Compound Name | 2-[methyl-(5-methyl-4-nitro-1H-pyrazole-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119359295 |
| Molecular Formula | C9H12N4O5 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-[methyl-(5-methyl-4-nitro-1H-pyrazole-3-carbonyl)amino]propanoic acid |
| SMILES | Cc1[nH]nc(C(=O)N(C)C(C)C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N4O5/c1-4-7(13(17)18)6(11-10-4)8(14)12(3)5(2)9(15)16/h5H,1-3H3,(H,10,11)(H,15,16) |
| InChIKey | RHSHETAQAGETEU-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 129.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|