C15H19N5O3 — CID 95339482
N,5-dimethyl-N-[(1S)-2-methyl-1-pyridin-3-ylpropyl]-4-nitro-1H-pyrazole-3-carboxamide (PubChem CID 95339482) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is N,5-dimethyl-N-[(1S)-2-methyl-1-pyridin-3-ylpropyl]-4-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | N,5-dimethyl-N-[(1S)-2-methyl-1-pyridin-3-ylpropyl]-4-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 95339482 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N,5-dimethyl-N-[(1S)-2-methyl-1-pyridin-3-ylpropyl]-4-nitro-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)N(C)[C@H](c2cccnc2)C(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19N5O3/c1-9(2)13(11-6-5-7-16-8-11)19(4)15(21)12-14(20(22)23)10(3)17-18-12/h5-9,13H,1-4H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | PEFKVDTZXQERHT-ZDUSSCGKSA-N |
| XLogP | 2.49 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|