C14H17N5O4 — CID 60614236
5-methyl-4-nitro-N-[(2-propoxy-3-pyridinyl)methyl]-1H-pyrazole-3-carboxamide (PubChem CID 60614236) has the molecular formula C14H17N5O4 and a molecular weight of 319.32 g/mol. Its IUPAC name is 5-methyl-4-nitro-N-[(2-propoxy-3-pyridinyl)methyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-methyl-4-nitro-N-[(2-propoxy-3-pyridinyl)methyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 60614236 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 5-methyl-4-nitro-N-[(2-propoxy-3-pyridinyl)methyl]-1H-pyrazole-3-carboxamide |
| SMILES | CCCOc1ncccc1CNC(=O)c1n[nH]c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17N5O4/c1-3-7-23-14-10(5-4-6-15-14)8-16-13(20)11-12(19(21)22)9(2)17-18-11/h4-6H,3,7-8H2,1-2H3,(H,16,20)(H,17,18) |
| InChIKey | SIZACGLJIATGNS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|