C7H7N3O6 — CID 67556897
2-(5-methyl-4-nitro-1H-pyrazol-3-yl)propanedioic acid (PubChem CID 67556897) has the molecular formula C7H7N3O6 and a molecular weight of 229.15 g/mol. Its IUPAC name is 2-(5-methyl-4-nitro-1H-pyrazol-3-yl)propanedioic acid.
| Compound Name | 2-(5-methyl-4-nitro-1H-pyrazol-3-yl)propanedioic acid |
|---|---|
| PubChem CID | 67556897 |
| Molecular Formula | C7H7N3O6 |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 2-(5-methyl-4-nitro-1H-pyrazol-3-yl)propanedioic acid |
| SMILES | Cc1[nH]nc(C(C(=O)O)C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N3O6/c1-2-5(10(15)16)4(9-8-2)3(6(11)12)7(13)14/h3H,1H3,(H,8,9)(H,11,12)(H,13,14) |
| InChIKey | VAVZRZZEQZCKDZ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 146.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|