C6H7N3O5S — CID 11885585
2-[(R)-(5-methyl-4-nitro-1H-pyrazol-3-yl)sulfinyl]acetic acid (PubChem CID 11885585) has the molecular formula C6H7N3O5S and a molecular weight of 233.20 g/mol. Its IUPAC name is 2-[(R)-(5-methyl-4-nitro-1H-pyrazol-3-yl)sulfinyl]acetic acid.
| Compound Name | 2-[(R)-(5-methyl-4-nitro-1H-pyrazol-3-yl)sulfinyl]acetic acid |
|---|---|
| PubChem CID | 11885585 |
| Molecular Formula | C6H7N3O5S |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 2-[(R)-(5-methyl-4-nitro-1H-pyrazol-3-yl)sulfinyl]acetic acid |
| SMILES | Cc1[nH]nc([S@](=O)CC(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H7N3O5S/c1-3-5(9(12)13)6(8-7-3)15(14)2-4(10)11/h2H2,1H3,(H,7,8)(H,10,11)/t15-/m1/s1 |
| InChIKey | IZZBZKPDICQHEE-OAHLLOKOSA-N |
| XLogP | -0.18 |
| TPSA | 126.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|