C7H10N4O2 — CID 3104739
5-methyl-4-nitro-N-prop-2-enyl-1H-pyrazol-3-amine (PubChem CID 3104739) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is 5-methyl-4-nitro-N-prop-2-enyl-1H-pyrazol-3-amine.
| Compound Name | 5-methyl-4-nitro-N-prop-2-enyl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 3104739 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 5-methyl-4-nitro-N-prop-2-enyl-1H-pyrazol-3-amine |
| SMILES | C=CCNc1n[nH]c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H10N4O2/c1-3-4-8-7-6(11(12)13)5(2)9-10-7/h3H,1,4H2,2H3,(H2,8,9,10) |
| InChIKey | GGMCNUOABIKFRW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|