About 3-N,3-N-dimethyl-4-nitro-5-N-prop-2-enyl-1H-pyrazole-3,5-diamine
3-N,3-N-dimethyl-4-nitro-5-N-prop-2-enyl-1H-pyrazole-3,5-diamine (PubChem CID 12708078) has the molecular formula C8H13N5O2
and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-N,3-N-dimethyl-4-nitro-5-N-prop-2-enyl-1H-pyrazole-3,5-diamine.
Molecular Properties
| Compound Name | 3-N,3-N-dimethyl-4-nitro-5-N-prop-2-enyl-1H-pyrazole-3,5-diamine |
| PubChem CID | 12708078 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 3-N,3-N-dimethyl-4-nitro-5-N-prop-2-enyl-1H-pyrazole-3,5-diamine |
| SMILES | C=CCNc1[nH]nc(N(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H13N5O2/c1-4-5-9-7-6(13(14)15)8(11-10-7)12(2)3/h4H,1,5H2,2-3H3,(H2,9,10,11) |
| InChIKey | LKVKVJBEXVBDDH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-N,3-N-dimethyl-4-nitro-5-N-prop-2-enyl-1H-pyrazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,3-N-dimethyl-4-nitro-5-N-prop-2-enyl-1H-pyrazole-3,5-diamine?
The IUPAC name of 3-N,3-N-dimethyl-4-nitro-5-N-prop-2-enyl-1H-pyrazole-3,5-diamine (CID 12708078) is 3-N,3-N-dimethyl-4-nitro-5-N-prop-2-enyl-1H-pyrazole-3,5-diamine.
What is the SMILES notation for 3-N,3-N-dimethyl-4-nitro-5-N-prop-2-enyl-1H-pyrazole-3,5-diamine?
The canonical SMILES for 3-N,3-N-dimethyl-4-nitro-5-N-prop-2-enyl-1H-pyrazole-3,5-diamine is C=CCNc1[nH]nc(N(C)C)c1[N+](=O)[O-].
What is the InChIKey of 3-N,3-N-dimethyl-4-nitro-5-N-prop-2-enyl-1H-pyrazole-3,5-diamine?
The InChIKey is LKVKVJBEXVBDDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O2/c1-4-5-9-7-6(13(14)15)8(11-10-7)12(2)3/h4H,1,5H2,2-3H3,(H2,9,10,11).
What are the key properties of 3-N,3-N-dimethyl-4-nitro-5-N-prop-2-enyl-1H-pyrazole-3,5-diamine?
3-N,3-N-dimethyl-4-nitro-5-N-prop-2-enyl-1H-pyrazole-3,5-diamine has a molecular weight of 211.22 g/mol, XLogP of 0.98, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,3-N-dimethyl-4-nitro-5-N-prop-2-enyl-1H-pyrazole-3,5-diamine is sourced from PubChem (CID 12708078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).