C10H18N6O2 — CID 11528966
2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-5-nitropyrimidine-2,4,6-triamine (PubChem CID 11528966) has the molecular formula C10H18N6O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-5-nitropyrimidine-2,4,6-triamine.
| Compound Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-5-nitropyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 11528966 |
| Molecular Formula | C10H18N6O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-5-nitropyrimidine-2,4,6-triamine |
| SMILES | CN(C)c1nc(N(C)C)c([N+](=O)[O-])c(N(C)C)n1 |
| InChI | InChI=1S/C10H18N6O2/c1-13(2)8-7(16(17)18)9(14(3)4)12-10(11-8)15(5)6/h1-6H3 |
| InChIKey | XHLREVXCIXNKMI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 78.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|