C10H15N7O3 — CID 133487602
5-[[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]methyl]-N,N-dimethyl-1,2,4-oxadiazol-3-amine (PubChem CID 133487602) has the molecular formula C10H15N7O3 and a molecular weight of 281.28 g/mol. Its IUPAC name is 5-[[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]methyl]-N,N-dimethyl-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-[[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]methyl]-N,N-dimethyl-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 133487602 |
| Molecular Formula | C10H15N7O3 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 5-[[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]methyl]-N,N-dimethyl-1,2,4-oxadiazol-3-amine |
| SMILES | Cc1nn(C)c(NCc2nc(N(C)C)no2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N7O3/c1-6-8(17(18)19)9(16(4)13-6)11-5-7-12-10(14-20-7)15(2)3/h11H,5H2,1-4H3 |
| InChIKey | NUBPLVMAICMBJM-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|