C11H11F2N5O3 — CID 133487627
5-[(2,6-difluoro-4-nitroanilino)methyl]-N,N-dimethyl-1,2,4-oxadiazol-3-amine (PubChem CID 133487627) has the molecular formula C11H11F2N5O3 and a molecular weight of 299.24 g/mol. Its IUPAC name is 5-[(2,6-difluoro-4-nitroanilino)methyl]-N,N-dimethyl-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-[(2,6-difluoro-4-nitroanilino)methyl]-N,N-dimethyl-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 133487627 |
| Molecular Formula | C11H11F2N5O3 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 5-[(2,6-difluoro-4-nitroanilino)methyl]-N,N-dimethyl-1,2,4-oxadiazol-3-amine |
| SMILES | CN(C)c1noc(CNc2c(F)cc([N+](=O)[O-])cc2F)n1 |
| InChI | InChI=1S/C11H11F2N5O3/c1-17(2)11-15-9(21-16-11)5-14-10-7(12)3-6(18(19)20)4-8(10)13/h3-4,14H,5H2,1-2H3 |
| InChIKey | ZUCHAHJYDAJUKU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|