C9H21N7 — CID 159451135
azane;2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 159451135) has the molecular formula C9H21N7 and a molecular weight of 227.32 g/mol. Its IUPAC name is azane;2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | azane;2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 159451135 |
| Molecular Formula | C9H21N7 |
| Molecular Weight | 227.32 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | azane;2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(N(C)C)nc(N(C)C)n1.N |
| InChI | InChI=1S/C9H18N6.H3N/c1-13(2)7-10-8(14(3)4)12-9(11-7)15(5)6;/h1-6H3;1H3 |
| InChIKey | LTJWFFWMIYQYHY-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |