C11H22N6O2 — CID 54434070
1-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-methylamino]-1-methoxyethanol (PubChem CID 54434070) has the molecular formula C11H22N6O2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 1-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-methylamino]-1-methoxyethanol.
| Compound Name | 1-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-methylamino]-1-methoxyethanol |
|---|---|
| PubChem CID | 54434070 |
| Molecular Formula | C11H22N6O2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 1-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-methylamino]-1-methoxyethanol |
| SMILES | COC(C)(O)N(C)c1nc(N(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H22N6O2/c1-11(18,19-7)17(6)10-13-8(15(2)3)12-9(14-10)16(4)5/h18H,1-7H3 |
| InChIKey | WJMXMCIIAFOTAH-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|