C18H36N6O6 — CID 151176957
2-N,4-N,4-N,6-N,6-N-pentamethyl-2-N-[3,3,3-trimethoxy-2-(trimethoxymethyl)propyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 151176957) has the molecular formula C18H36N6O6 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-N,4-N,4-N,6-N,6-N-pentamethyl-2-N-[3,3,3-trimethoxy-2-(trimethoxymethyl)propyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,4-N,6-N,6-N-pentamethyl-2-N-[3,3,3-trimethoxy-2-(trimethoxymethyl)propyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 151176957 |
| Molecular Formula | C18H36N6O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 2-N,4-N,4-N,6-N,6-N-pentamethyl-2-N-[3,3,3-trimethoxy-2-(trimethoxymethyl)propyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | COC(OC)(OC)C(CN(C)c1nc(N(C)C)nc(N(C)C)n1)C(OC)(OC)OC |
| InChI | InChI=1S/C18H36N6O6/c1-22(2)14-19-15(23(3)4)21-16(20-14)24(5)12-13(17(25-6,26-7)27-8)18(28-9,29-10)30-11/h13H,12H2,1-11H3 |
| InChIKey | NDLTYDVLGNWILF-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 103.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|