C11H23N7 — CID 80895012
6-hydrazinyl-2-N,4-N,4-N-trimethyl-2-N-(2-methylbutyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80895012) has the molecular formula C11H23N7 and a molecular weight of 253.35 g/mol. Its IUPAC name is 6-hydrazinyl-2-N,4-N,4-N-trimethyl-2-N-(2-methylbutyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-hydrazinyl-2-N,4-N,4-N-trimethyl-2-N-(2-methylbutyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80895012 |
| Molecular Formula | C11H23N7 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 6-hydrazinyl-2-N,4-N,4-N-trimethyl-2-N-(2-methylbutyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCC(C)CN(C)c1nc(NN)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H23N7/c1-6-8(2)7-18(5)11-14-9(16-12)13-10(15-11)17(3)4/h8H,6-7,12H2,1-5H3,(H,13,14,15,16) |
| InChIKey | LXUZQIBTTVYOTP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|