C12H24N8 — CID 80896860
6-hydrazinyl-4-N,4-N-dimethyl-2-N-(1-pyrrolidin-1-ylpropan-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 80896860) has the molecular formula C12H24N8 and a molecular weight of 280.38 g/mol. Its IUPAC name is 6-hydrazinyl-4-N,4-N-dimethyl-2-N-(1-pyrrolidin-1-ylpropan-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-hydrazinyl-4-N,4-N-dimethyl-2-N-(1-pyrrolidin-1-ylpropan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80896860 |
| Molecular Formula | C12H24N8 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.21 |
| IUPAC Name | 6-hydrazinyl-4-N,4-N-dimethyl-2-N-(1-pyrrolidin-1-ylpropan-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(CN1CCCC1)Nc1nc(NN)nc(N(C)C)n1 |
| InChI | InChI=1S/C12H24N8/c1-9(8-20-6-4-5-7-20)14-10-15-11(18-13)17-12(16-10)19(2)3/h9H,4-8,13H2,1-3H3,(H2,14,15,16,17,18) |
| InChIKey | MPGRWSIFTXYPJL-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|