C12H23N7O2 — CID 80901228
4-ethoxy-6-hydrazinyl-N-(1-morpholin-4-ylpropan-2-yl)-1,3,5-triazin-2-amine (PubChem CID 80901228) has the molecular formula C12H23N7O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 4-ethoxy-6-hydrazinyl-N-(1-morpholin-4-ylpropan-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-6-hydrazinyl-N-(1-morpholin-4-ylpropan-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80901228 |
| Molecular Formula | C12H23N7O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 4-ethoxy-6-hydrazinyl-N-(1-morpholin-4-ylpropan-2-yl)-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(NN)nc(NC(C)CN2CCOCC2)n1 |
| InChI | InChI=1S/C12H23N7O2/c1-3-21-12-16-10(15-11(17-12)18-13)14-9(2)8-19-4-6-20-7-5-19/h9H,3-8,13H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | HWUBCJICQDCWPW-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 110.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|