C9H21N6O4P — CID 172706081
2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-1,3,5-triazine-2,4,6-triamine;phosphoric acid (PubChem CID 172706081) has the molecular formula C9H21N6O4P and a molecular weight of 308.28 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-1,3,5-triazine-2,4,6-triamine;phosphoric acid.
| Compound Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-1,3,5-triazine-2,4,6-triamine;phosphoric acid |
|---|---|
| PubChem CID | 172706081 |
| Molecular Formula | C9H21N6O4P |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-1,3,5-triazine-2,4,6-triamine;phosphoric acid |
| SMILES | CN(C)c1nc(N(C)C)nc(N(C)C)n1.O=P(O)(O)O |
| InChI | InChI=1S/C9H18N6.H3O4P/c1-13(2)7-10-8(14(3)4)12-9(11-7)15(5)6;1-5(2,3)4/h1-6H3;(H3,1,2,3,4) |
| InChIKey | DPJUGLKHOMJBOW-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|