C12H19N5O2S — CID 7439901
(E)-3-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]sulfanyl]-4-hydroxypent-3-en-2-one (PubChem CID 7439901) has the molecular formula C12H19N5O2S and a molecular weight of 297.38 g/mol. Its IUPAC name is (E)-3-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]sulfanyl]-4-hydroxypent-3-en-2-one.
| Compound Name | (E)-3-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]sulfanyl]-4-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 7439901 |
| Molecular Formula | C12H19N5O2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | (E)-3-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]sulfanyl]-4-hydroxypent-3-en-2-one |
| SMILES | CC(=O)/C(Sc1nc(N(C)C)nc(N(C)C)n1)=C(/C)O |
| InChI | InChI=1S/C12H19N5O2S/c1-7(18)9(8(2)19)20-12-14-10(16(3)4)13-11(15-12)17(5)6/h18H,1-6H3/b9-7+ |
| InChIKey | HKHQYEWTEATHOQ-VQHVLOKHSA-N |
| XLogP | 1.47 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|