C5H6N4S2Zn — CID 110193115
zinc 6-(dimethylamino)-1,3,5-triazine-2,4-dithiolate (PubChem CID 110193115) has the molecular formula C5H6N4S2Zn and a molecular weight of 251.66 g/mol. Its IUPAC name is zinc 6-(dimethylamino)-1,3,5-triazine-2,4-dithiolate.
| Compound Name | zinc 6-(dimethylamino)-1,3,5-triazine-2,4-dithiolate |
|---|---|
| PubChem CID | 110193115 |
| Molecular Formula | C5H6N4S2Zn |
| Molecular Weight | 251.66 g/mol |
| Exact Mass | 249.93 |
| IUPAC Name | zinc 6-(dimethylamino)-1,3,5-triazine-2,4-dithiolate |
| SMILES | CN(C)c1nc([S-])nc([S-])n1.[Zn+2] |
| InChI | InChI=1S/C5H8N4S2.Zn/c1-9(2)3-6-4(10)8-5(11)7-3;/h1-2H3,(H2,6,7,8,10,11);/q;+2/p-2 |
| InChIKey | ROUKYHPVXRGDDW-UHFFFAOYSA-L |
| XLogP | -0.25 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.66 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|