About 5-(aminomethyl)-N,N,4,6-tetramethylpyrimidin-2-amine
5-(aminomethyl)-N,N,4,6-tetramethylpyrimidin-2-amine (PubChem CID 28814656) has the molecular formula C9H16N4
and a molecular weight of 180.25 g/mol. Its IUPAC name is 5-(aminomethyl)-N,N,4,6-tetramethylpyrimidin-2-amine.
Analyze 5-(aminomethyl)-N,N,4,6-tetramethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-N,N,4,6-tetramethylpyrimidin-2-amine?
The IUPAC name of 5-(aminomethyl)-N,N,4,6-tetramethylpyrimidin-2-amine (CID 28814656) is 5-(aminomethyl)-N,N,4,6-tetramethylpyrimidin-2-amine.
What is the SMILES notation for 5-(aminomethyl)-N,N,4,6-tetramethylpyrimidin-2-amine?
The canonical SMILES for 5-(aminomethyl)-N,N,4,6-tetramethylpyrimidin-2-amine is Cc1nc(N(C)C)nc(C)c1CN.
What is the InChIKey of 5-(aminomethyl)-N,N,4,6-tetramethylpyrimidin-2-amine?
The InChIKey is QIWXLMVFWXETBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4/c1-6-8(5-10)7(2)12-9(11-6)13(3)4/h5,10H2,1-4H3.
What are the key properties of 5-(aminomethyl)-N,N,4,6-tetramethylpyrimidin-2-amine?
5-(aminomethyl)-N,N,4,6-tetramethylpyrimidin-2-amine has a molecular weight of 180.25 g/mol, XLogP of 0.62, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-N,N,4,6-tetramethylpyrimidin-2-amine is sourced from PubChem (CID 28814656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).